| Sell. Cinnolin-3(2H)-one2015-04-07 |
Molecular formula:
Molecular weight: |
Company: Suzhou xinkai bio-medical technology co., ltd. [Tel:+86-0512-82216625] |
|
| Sell. 4-(CHLOROMETHYL)-1-METHYL-1H-IMIDAZOLE2015-04-07 |
Molecular formula:C5H7ClN2
Molecular weight:130.57548 |
Company: Suzhou xinkai bio-medical technology co., ltd. [Tel:+86-0512-82216625] |
|
| Sell. 2-Amino-5-hydroxypyrimidine2015-04-07 |
Molecular formula:C4H5N3O
Molecular weight:111.10 |
Company: Suzhou xinkai bio-medical technology co., ltd. [Tel:+86-0512-82216625] |
|
| Sell. 2-Chloro-5-(phenylmethoxy)-pyrimidine2015-04-07 |
Molecular formula:C11H9ClN2O
Molecular weight:220.66 |
Company: Suzhou xinkai bio-medical technology co., ltd. [Tel:+86-0512-82216625] |
|
| Sell. 2,5-DIBROMOTHIAZOLE2015-04-07 |
Molecular formula:C3HBr2NS
Molecular weight:242.92 |
Company: Suzhou xinkai bio-medical technology co., ltd. [Tel:+86-0512-82216625] |
|
| Sell. 2-bromo-5-hydroxy-N-[2-(4-hydroxyphenyl)ethyl]-4-methoxy-N-methyl- benzamide2015-04-07 |
Molecular formula:C17H18BrNO4
Molecular weight: |
Company: Jiangsu kunshan haizhuo bio-pharmaceutical co.,ltd [Tel:0086-512-57359652] |
|
| Sell. RD(TMQ)2015-04-01 |
| Origin: China
Package: 25kg/bag. Or follow the requirements.
Min. Order: 1 metric ton
Chemical Name: 2,2, |
Company: [Tel:] |
|
| Sell. RUBBER ACCELERATOR MBTS2015-04-01 |
| Trade name: MBTS,DM
Chemical Name: Dibenzothiazole disulfide
Molecular Formula: C14H8N2S4
Molecu |
Company: [Tel:] |
|
| Sell. RUBBER ACCELERATOR MBT2015-04-01 |
| Trade name: MBT,M
Chemical Name: 2-Mercaptobenzothiazole
Molecular Formula: C7H5NS2
Molecular W |
Company: [Tel:] |
|
| Sell. RUBBER ANTIOXIDANT IPPD2015-04-01 |
| Trade Name: 4010NA,IPPD
Chemical Name: N-Isopropyl-N-phenyl-p-phenylenediamine
Molecular Formula: C |
Company: [Tel:] |
|
| Sell. RUBBER ANTIOXIDANT 6PPD2015-04-01 |
| It applications include the use in pneumatic tire components, solid tires, belts, hoses, cable, automotive m |
Company: [Tel:] |
|
| Sell. UV ABSORBER UV-P2015-04-01 |
| This product is a high efficient uv absorber, which can effectively absorb 290-400 nm uv light. it is mainly |
Company: [Tel:] |
|
| Sell. UV ABSORBER UV-3282015-04-01 |
| This product is a high efficient uv absorber, maximum UV absorption peak of 345 nm of uv-328, good intermisc |
Company: [Tel:] |
|
| Sell. ANTIOXIDANT 10762015-04-01 |
| This product is a superior non polluting nontoxic antioxidant, has good heat resistance and water extraction |
Company: [Tel:] |
|
| Sell. ANTIOXIDANT 10102015-04-01 |
| Appearance for white powder, odorless and no pollution. Melting point is from 110 芒鈥炂?to 125 芒鈥炂 |
Company: [Tel:] |
|
| Sell. MELAMINE2015-04-01 |
| It is the main raw material of melamine formaldehyde resin, used as the organic elemental analysis reagent, |
Company: [Tel:] |
|
| Sell. 3,5-Dichlorobenzonitrile2015-04-01 |
Molecular formula:C7H3Cl2N
Molecular weight:172.01 |
Company: Wuxi kaili biotech co.,ltd [Tel:0510-80721533 87431966] |
|
| Sell. (R)-(+)-1,2-Diaminopropane dihydrochloride2015-04-01 |
Molecular formula:C3H10N2.2(HCl)
Molecular weight:147.05 |
Company: Wuxi kaili biotech co.,ltd [Tel:0510-80721533 87431966] |
|
| Sell. R)-(-)-2,2-Dimethyl-1,3-dioxolane-4-methanol2015-04-01 |
Molecular formula:C6H12O3
Molecular weight:132.16 |
Company: Wuxi kaili biotech co.,ltd [Tel:0510-80721533 87431966] |
|
| Sell. 4-Chloro-2,2:6,2-terpyridine2015-04-01 |
Molecular formula:C15H10ClN3
Molecular weight:267.71 |
Company: Wuxi kaili biotech co.,ltd [Tel:0510-80721533 87431966] |
|
