| Sell. 4-Aminobenzyl alcohol2015-04-07 |
Molecular formula:C7H9NO
Molecular weight:123.15 |
Company: Suzhou xinkai bio-medical technology co., ltd. [Tel:+86-0512-82216625] |
|
| Sell. (3aR,4S,6R,6aS)-6-Aminotetrahydro-2,2-dimethyl-4H-cyclopenta-1,3-dioxol-4-ol2015-04-07 |
Molecular formula:
Molecular weight: |
Company: Suzhou xinkai bio-medical technology co., ltd. [Tel:+86-0512-82216625] |
|
| Sell. N-(5-Amino-2-methylphenyl)-4-(3-pyridyl)-2-pyrimidineamine2015-04-07 |
Molecular formula:C16H15N5
Molecular weight:277.32 |
Company: Suzhou xinkai bio-medical technology co., ltd. [Tel:+86-0512-82216625] |
|
| Sell. L-2-THIENYLALANINE2015-04-07 |
Molecular formula:C7H9NO2S
Molecular weight:171.21 |
Company: Suzhou xinkai bio-medical technology co., ltd. [Tel:+86-0512-82216625] |
|
| Sell. tert-butyl 4-hydroxy-2-oxopiperidine-1-carboxylate2015-04-07 |
Molecular formula:
Molecular weight: |
Company: Suzhou xinkai bio-medical technology co., ltd. [Tel:+86-0512-82216625] |
|
| Sell. Cinnolin-3(2H)-one2015-04-07 |
Molecular formula:
Molecular weight: |
Company: Suzhou xinkai bio-medical technology co., ltd. [Tel:+86-0512-82216625] |
|
| Sell. 4-(CHLOROMETHYL)-1-METHYL-1H-IMIDAZOLE2015-04-07 |
Molecular formula:C5H7ClN2
Molecular weight:130.57548 |
Company: Suzhou xinkai bio-medical technology co., ltd. [Tel:+86-0512-82216625] |
|
| Sell. 2-Amino-5-hydroxypyrimidine2015-04-07 |
Molecular formula:C4H5N3O
Molecular weight:111.10 |
Company: Suzhou xinkai bio-medical technology co., ltd. [Tel:+86-0512-82216625] |
|
| Sell. 2-Chloro-5-(phenylmethoxy)-pyrimidine2015-04-07 |
Molecular formula:C11H9ClN2O
Molecular weight:220.66 |
Company: Suzhou xinkai bio-medical technology co., ltd. [Tel:+86-0512-82216625] |
|
| Sell. 2,5-DIBROMOTHIAZOLE2015-04-07 |
Molecular formula:C3HBr2NS
Molecular weight:242.92 |
Company: Suzhou xinkai bio-medical technology co., ltd. [Tel:+86-0512-82216625] |
|
| Sell. 2-bromo-5-hydroxy-N-[2-(4-hydroxyphenyl)ethyl]-4-methoxy-N-methyl- benzamide2015-04-07 |
Molecular formula:C17H18BrNO4
Molecular weight: |
Company: Jiangsu kunshan haizhuo bio-pharmaceutical co.,ltd [Tel:0086-512-57359652] |
|
| Sell. RD(TMQ)2015-04-01 |
| Origin: China
Package: 25kg/bag. Or follow the requirements.
Min. Order: 1 metric ton
Chemical Name: 2,2, |
Company: [Tel:] |
|
| Sell. RUBBER ACCELERATOR MBTS2015-04-01 |
| Trade name: MBTS,DM
Chemical Name: Dibenzothiazole disulfide
Molecular Formula: C14H8N2S4
Molecu |
Company: [Tel:] |
|
| Sell. RUBBER ACCELERATOR MBT2015-04-01 |
| Trade name: MBT,M
Chemical Name: 2-Mercaptobenzothiazole
Molecular Formula: C7H5NS2
Molecular W |
Company: [Tel:] |
|
| Sell. RUBBER ANTIOXIDANT IPPD2015-04-01 |
| Trade Name: 4010NA,IPPD
Chemical Name: N-Isopropyl-N-phenyl-p-phenylenediamine
Molecular Formula: C |
Company: [Tel:] |
|
| Sell. RUBBER ANTIOXIDANT 6PPD2015-04-01 |
| It applications include the use in pneumatic tire components, solid tires, belts, hoses, cable, automotive m |
Company: [Tel:] |
|
| Sell. UV ABSORBER UV-P2015-04-01 |
| This product is a high efficient uv absorber, which can effectively absorb 290-400 nm uv light. it is mainly |
Company: [Tel:] |
|
| Sell. UV ABSORBER UV-3282015-04-01 |
| This product is a high efficient uv absorber, maximum UV absorption peak of 345 nm of uv-328, good intermisc |
Company: [Tel:] |
|
| Sell. ANTIOXIDANT 10762015-04-01 |
| This product is a superior non polluting nontoxic antioxidant, has good heat resistance and water extraction |
Company: [Tel:] |
|
| Sell. ANTIOXIDANT 10102015-04-01 |
| Appearance for white powder, odorless and no pollution. Melting point is from 110 芒鈥炂?to 125 芒鈥炂 |
Company: [Tel:] |
|
