| Sell. hydrocarbon resin 8#2011-12-14 |
| Characteristics of products: C9 Petroleum resin is a flake solid of light yellow and dark brown, with excell |
Company: Tangshan kerun chemicals co.,ltd [Tel:0315-3122038] |
|
| Sell. Fmoc-NH-PEG1-CH2COOH2011-12-14 |
Molecular formula:
Molecular weight: |
Company: Shanghai gardenbiochem. technology co.,ltd. [Tel:+86-21-50800786] |
|
| Sell. Fmoc-NH-PEG2-CH2COOH2011-12-14 |
Molecular formula:C21H23NO6
Molecular weight:385.41 |
Company: Shanghai gardenbiochem. technology co.,ltd. [Tel:+86-21-50800786] |
|
| Sell. Fmoc-NH-PEG3-CH2COOH2011-12-14 |
Molecular formula:
Molecular weight: |
Company: Shanghai gardenbiochem. technology co.,ltd. [Tel:+86-21-50800786] |
|
| Sell. Fmoc-NH-PEG4-CH2COOH2011-12-14 |
Molecular formula:
Molecular weight: |
Company: Shanghai gardenbiochem. technology co.,ltd. [Tel:+86-21-50800786] |
|
| Sell. Fmoc-NH-PEG5-CH2COOH2011-12-14 |
Molecular formula:
Molecular weight: |
Company: Shanghai gardenbiochem. technology co.,ltd. [Tel:+86-21-50800786] |
|
| Sell. Fmoc-NH-PEG8-CH2COOH2011-12-14 |
Molecular formula:
Molecular weight: |
Company: Shanghai gardenbiochem. technology co.,ltd. [Tel:+86-21-50800786] |
|
| Sell. Fmoc-NH-(PEG)2-CH2CH2COOH2011-12-14 |
Molecular formula:
Molecular weight: |
Company: Shanghai gardenbiochem. technology co.,ltd. [Tel:+86-21-50800786] |
|
| Sell. Fmoc-NH-(PEG)3-CH2CH2COOH2011-12-14 |
|
Company: Shanghai gardenbiochem. technology co.,ltd. [Tel:+86-21-50800786] |
|
| Sell. Fmoc-NH-(PEG)4-CH2CH2COOH2011-12-14 |
|
Company: Shanghai gardenbiochem. technology co.,ltd. [Tel:+86-21-50800786] |
|
| Sell. Fmoc-NH-(PEG)5-CH2CH2COOH2011-12-14 |
|
Company: Shanghai gardenbiochem. technology co.,ltd. [Tel:+86-21-50800786] |
|
| Sell. Fmoc-21-amino-4,7,10,13,16,19-hexaoxaheneicosanoic acid2011-12-14 |
|
Company: Shanghai gardenbiochem. technology co.,ltd. [Tel:+86-21-50800786] |
|
| Sell. Fmoc-NH-(PEG)8-CH2CH2COOH2011-12-14 |
Molecular formula:
Molecular weight: |
Company: Shanghai gardenbiochem. technology co.,ltd. [Tel:+86-21-50800786] |
|
| Sell. Fmoc-NH-(PEG)9-CH2CH2COOH2011-12-14 |
Molecular formula:
Molecular weight: |
Company: Shanghai gardenbiochem. technology co.,ltd. [Tel:+86-21-50800786] |
|
| Sell. Boc-NH-PEG4-CH2CH2COOH (16 atoms)2011-12-14 |
Molecular formula:
Molecular weight: |
Company: Shanghai gardenbiochem. technology co.,ltd. [Tel:+86-21-50800786] |
|
| Sell. Boc-NH-PEG6-CH2CH2COOH (22 atoms)2011-12-14 |
Molecular formula:
Molecular weight: |
Company: Shanghai gardenbiochem. technology co.,ltd. [Tel:+86-21-50800786] |
|
| Sell. CBZ-AEEA;CBZ-NH-PEG2-CH2COOH2011-12-14 |
Molecular formula:
Molecular weight: |
Company: Shanghai gardenbiochem. technology co.,ltd. [Tel:+86-21-50800786] |
|
| Sell. CBZ-AEEEA;CBZ-NH-PEG3-CH2COOH2011-12-14 |
Molecular formula:
Molecular weight: |
Company: Shanghai gardenbiochem. technology co.,ltd. [Tel:+86-21-50800786] |
|
| Sell. CBZ-NH-PEG4-CH2CH2COOH2011-12-14 |
Molecular formula:
Molecular weight: |
Company: Shanghai gardenbiochem. technology co.,ltd. [Tel:+86-21-50800786] |
|
| Sell. H-Trp-Gly-OH2011-12-14 |
Molecular formula:C13H15N3O3
Molecular weight:261.28 |
Company: Shanghai gardenbiochem. technology co.,ltd. [Tel:+86-21-50800786] |
|
