| Sell. Boc-D-Pro-ol2016-11-28 |
Molecular formula:C10H19NO3 Molecular weight:201.26 |
Company: Chengdu aminotp phatmaceutical technology co.,ltd. [Tel:0086-28-85755578] |
|
| Sell. Boc-Phe(4-NO2)-OH2016-11-28 |
Molecular formula:C14H18N2O6 Molecular weight:310.31 |
Company: Chengdu aminotp phatmaceutical technology co.,ltd. [Tel:0086-28-85755578] |
|
| Sell. Boc-His(Trt)-OH2016-11-28 |
Molecular formula:C30H31N3O4 Molecular weight:497.5 |
Company: Chengdu aminotp phatmaceutical technology co.,ltd. [Tel:0086-28-85755578] |
|
| Sell. Boc-Glu(OBzl)-OH2016-11-28 |
Molecular formula:C17H23NO6 Molecular weight:337.37 |
Company: Chengdu aminotp phatmaceutical technology co.,ltd. [Tel:0086-28-85755578] |
|
| Sell. Boc-Gly-OH2016-11-28 |
Molecular formula:C7H13NO4 Molecular weight:175.18 |
Company: Chengdu aminotp phatmaceutical technology co.,ltd. [Tel:0086-28-85755578] |
|
| Sell. Boc-Dap-OH2016-11-28 |
Molecular formula:C8H16N2O4 Molecular weight:204.22 |
Company: Chengdu aminotp phatmaceutical technology co.,ltd. [Tel:0086-28-85755578] |
|
| Sell. Boc-Dab-OH2016-11-28 |
Molecular formula:C9H18N2O4 Molecular weight:218.25 |
Company: Chengdu aminotp phatmaceutical technology co.,ltd. [Tel:0086-28-85755578] |
|
| Sell. Boc-Arg(NO2)-OH2016-11-28 |
Molecular formula:C11H21N5O6 Molecular weight:319.31 |
Company: Chengdu aminotp phatmaceutical technology co.,ltd. [Tel:0086-28-85755578] |
|
| Sell. Boc-D-Ala-OH2016-11-28 |
Molecular formula:C8H15NO4 Molecular weight:189.21 |
Company: Chengdu aminotp phatmaceutical technology co.,ltd. [Tel:0086-28-85755578] |
|
| Sell. Boc-D-Asn(Trt)-OH2016-11-28 |
Molecular formula:C28H30N2O5 Molecular weight: |
Company: Chengdu aminotp phatmaceutical technology co.,ltd. [Tel:0086-28-85755578] |
|
| Sell. Boc-Cys(Acm)-OH2016-11-28 |
Molecular formula:C11H20N2O5S Molecular weight:292.36 |
Company: Chengdu aminotp phatmaceutical technology co.,ltd. [Tel:0086-28-85755578] |
|
| Sell. Boc-Ser(Bzl)-OH2016-11-28 |
Molecular formula:C15H21NO5 Molecular weight:295.33 |
Company: Chengdu aminotp phatmaceutical technology co.,ltd. [Tel:0086-28-85755578] |
|
| Sell. Boc-Pro-OH2016-11-28 |
Molecular formula:C10H17NO4 Molecular weight:215.25 |
Company: Chengdu aminotp phatmaceutical technology co.,ltd. [Tel:0086-28-85755578] |
|
| Sell. Boc-Glu-OBzl2016-11-28 |
Molecular formula:C17H23NO6 Molecular weight:337.37 |
Company: Chengdu aminotp phatmaceutical technology co.,ltd. [Tel:0086-28-85755578] |
|
| Sell. Basic copper carbonate cupric carbonate Kupfercarbonat Carbonato de cobre Carbonate de cuivre Koper(II)carbonaat2016-11-20 |
| Copper Carbonate
Basic copper carbonate is a green solid completely insoluble in water, alcohol and organic |
Company: Qiruide chemical auxiliary Agents Co.,Ltd [Tel:86-15655279163] |
|
| Sell. Copper(II) sulfate Kupfersulfat Sulfato de cobre Sulfate de cuivre Tembaga(II) sulfat Siarczan miedzi Sulfat de cupru2016-11-20 |
| Copper (II) sulfate, also known as cupric sulfate or copper sulphate, is the inorganic compound with the che |
Company: Qiruide chemical auxiliary Agents Co.,Ltd [Tel:86-15655279163] |
|
| Sell. Copper(II) acetate Kupfer(II)-acetat Acetato de cobre (II) Tembaga(II) asetat Octan miedzi(II) Acetato de cobre(II)2016-11-20 |
| Copper(II) Acetate is odorless and efflorescent. It is soluble in alcohol and slightly soluble in ether and |
Company: Qiruide chemical auxiliary Agents Co.,Ltd [Tel:86-15655279163] |
|
| Sell. Strontium chromate Strontiumchromaat Strontiumchromat Stronsiyum kromat Stroncijum hromat2016-11-20 |
| Strontium chromate refers to a chemical compound that is a light yellow powder or granular solid and insolub |
Company: Qiruide chemical auxiliary Agents Co.,Ltd [Tel:86-15655279163] |
|
| Sell. Chromium(III) hydroxide Chrom(III)-hydroxid Kromihydroksidi Hrom(III) hidroksid chromic hydroxide2016-11-20 |
| Chromium(III) hydroxide is an inorganic compound with the chemical formula
Cr(OH)3. It is used as a pigment |
Company: Qiruide chemical auxiliary Agents Co.,Ltd [Tel:86-15655279163] |
|
| Sell. Chromium(III) oxide Chrom(III)-oxid Oxyde de chrome(III) Kromium(III) oksida Chroom(III)oxide Oxid de crom (III)2016-11-20 |
| Chromium(III) oxide is the inorganic compound of the formula Cr2O3.
It is one of the principal oxides of ch |
Company: Qiruide chemical auxiliary Agents Co.,Ltd [Tel:86-15655279163] |
|