| Sell. Potassium Formate2011-12-16 |
| NO Product Name Specification CAS Packing MSDS
CT3003 Potassium Acetate 98%min 127-08-2 25kgs Bag MSDS
C |
Company: Tianjin zhongxin chemtech co.,ltd. [Tel:86-22-25206778] |
|
| Sell. Petroleum resin -dark2011-12-14 |
| Characteristics of products: C9 Petroleum resin is a flake solid of light yellow and dark brown, with excell |
Company: Tangshan kerun chemicals co.,ltd [Tel:0315-3122038] |
|
| Sell. PETROLEUM RESIN 18#2011-12-14 |
| Characteristics of products: C9 Petroleum resin is a flake solid of light yellow and dark brown, with excell |
Company: Tangshan kerun chemicals co.,ltd [Tel:0315-3122038] |
|
| Sell. petroleum resin 13#2011-12-14 |
| Characteristics of products: C9 Petroleum resin is a flake solid of light yellow and dark brown, with excell |
Company: Tangshan kerun chemicals co.,ltd [Tel:0315-3122038] |
|
| Sell. petroleum resin - 12#2011-12-14 |
| Characteristics of products: C9 Petroleum resin is a flake solid of light yellow and dark brown, with excell |
Company: Tangshan kerun chemicals co.,ltd [Tel:0315-3122038] |
|
| Sell. petroleum resin - 11#2011-12-14 |
| Characteristics of products: C9 Petroleum resin is a flake solid of light yellow and dark brown, with excell |
Company: Tangshan kerun chemicals co.,ltd [Tel:0315-3122038] |
|
| Sell. petroleum resin 10#2011-12-14 |
| Characteristics of products: C9 Petroleum resin is a flake solid of light yellow and dark brown, with excell |
Company: Tangshan kerun chemicals co.,ltd [Tel:0315-3122038] |
|
| Sell. hydrocarbon resin 8#2011-12-14 |
| Characteristics of products: C9 Petroleum resin is a flake solid of light yellow and dark brown, with excell |
Company: Tangshan kerun chemicals co.,ltd [Tel:0315-3122038] |
|
| Sell. Fmoc-NH-PEG1-CH2COOH2011-12-14 |
Molecular formula: Molecular weight: |
Company: Shanghai gardenbiochem. technology co.,ltd. [Tel:+86-21-50800786] |
|
| Sell. Fmoc-NH-PEG2-CH2COOH2011-12-14 |
Molecular formula:C21H23NO6 Molecular weight:385.41 |
Company: Shanghai gardenbiochem. technology co.,ltd. [Tel:+86-21-50800786] |
|
| Sell. Fmoc-NH-PEG3-CH2COOH2011-12-14 |
Molecular formula: Molecular weight: |
Company: Shanghai gardenbiochem. technology co.,ltd. [Tel:+86-21-50800786] |
|
| Sell. Fmoc-NH-PEG4-CH2COOH2011-12-14 |
Molecular formula: Molecular weight: |
Company: Shanghai gardenbiochem. technology co.,ltd. [Tel:+86-21-50800786] |
|
| Sell. Fmoc-NH-PEG5-CH2COOH2011-12-14 |
Molecular formula: Molecular weight: |
Company: Shanghai gardenbiochem. technology co.,ltd. [Tel:+86-21-50800786] |
|
| Sell. Fmoc-NH-PEG8-CH2COOH2011-12-14 |
Molecular formula: Molecular weight: |
Company: Shanghai gardenbiochem. technology co.,ltd. [Tel:+86-21-50800786] |
|
| Sell. Fmoc-NH-(PEG)2-CH2CH2COOH2011-12-14 |
Molecular formula: Molecular weight: |
Company: Shanghai gardenbiochem. technology co.,ltd. [Tel:+86-21-50800786] |
|
| Sell. Fmoc-NH-(PEG)3-CH2CH2COOH2011-12-14 |
|
Company: Shanghai gardenbiochem. technology co.,ltd. [Tel:+86-21-50800786] |
|
| Sell. Fmoc-NH-(PEG)4-CH2CH2COOH2011-12-14 |
|
Company: Shanghai gardenbiochem. technology co.,ltd. [Tel:+86-21-50800786] |
|
| Sell. Fmoc-NH-(PEG)5-CH2CH2COOH2011-12-14 |
|
Company: Shanghai gardenbiochem. technology co.,ltd. [Tel:+86-21-50800786] |
|
| Sell. Fmoc-21-amino-4,7,10,13,16,19-hexaoxaheneicosanoic acid2011-12-14 |
|
Company: Shanghai gardenbiochem. technology co.,ltd. [Tel:+86-21-50800786] |
|
| Sell. Fmoc-NH-(PEG)8-CH2CH2COOH2011-12-14 |
Molecular formula: Molecular weight: |
Company: Shanghai gardenbiochem. technology co.,ltd. [Tel:+86-21-50800786] |
|